Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CCCP is an oxidative phosphorylation uncoupler. CCCP induces activation of PINK1 leading to Parkin Ser65 phosphorylation. |
|---|
| Catalog Num | A20342 |
|---|---|
| Formula | C9H5ClN4 |
| Molecular Weight | 204.62 |
| CAS Number | 555-60-2 |
| SMILES | N#C/C(C#N)=N/NC1=CC=CC(Cl)=C1 |
| Synonyms | Carbonyl cyanide 3-chlorophenylhydrazone; Carbonyl Cyanide m-Chlorophenylhydrazone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (171.05 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (87.96 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.87 mL | 244.36 mL | 488.71 mL |
| 0.5 mM | 9.77 mL | 48.87 mL | 97.74 mL |
| 1 mM | 4.89 mL | 24.44 mL | 48.87 mL |
| 5 mM | 0.98 mL | 4.89 mL | 9.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
