Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CDN1163 is a SERCA2 allosteric activator. It increases Ca2+-ATPase activity and Ca2+ uptake by ER microsomes from obese mice. Rescues HEK cells from ER stress-induced cell death. |
|---|
| Catalog Num | A16951 |
|---|---|
| Formula | C20H20N2O2 |
| Molecular Weight | 320.38 |
| CAS Number | 892711-75-0 |
| SMILES | O=C(NC1=C2N=C(C)C=CC2=CC=C1)C3=CC=C(OC(C)C)C=C3 |
| Synonyms | CDN 1163, CDN-1163 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (196.63 mM) | |
| Water | Insoluble | ||
| Ethanol | 63 mg/mL (196.63 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.21 mL | 156.06 mL | 312.13 mL |
| 0.5 mM | 6.24 mL | 31.21 mL | 62.43 mL |
| 1 mM | 3.12 mL | 15.61 mL | 31.21 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
