Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefadroxil, also known as Duricef, is an antibiotic effective against pyodermic skin diseases, such as Staphylococcus aureus and Streptococcus pyogenes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17261 |
|---|---|
| Formula | C16H19N3O6S |
| Molecular Weight | 381.403 |
| CAS Number | 66592-87-8 |
| SMILES | O=C(C(N12)=C(C)CS[C@]2([H])[C@H](NC([C@H](N)C3=CC=C(O)C=C3)=O)C1=O)O.[H]O[H] |
| Synonyms | Duricef; Cefadroxil; Cefadroxil monohydrate; Bidocel |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (15.73 mM) | |
| Water | 1 mg/mL (2.62 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.22 mL | 131.09 mL | 262.19 mL |
| 0.5 mM | 5.24 mL | 26.22 mL | 52.44 mL |
| 1 mM | 2.62 mL | 13.11 mL | 26.22 mL |
| 5 mM | 0.52 mL | 2.62 mL | 5.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
