Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefuroxime axetil is a second generation cephalosporin antibiotic with a broad spectrum activity against Gram positive and Gram negative bacteria. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17424 |
|---|---|
| Formula | C20H22N4O10S |
| Molecular Weight | 510.47 |
| CAS Number | 64544-07-6 |
| SMILES | O=C(C(N12)=C(COC(N)=O)CS[C@]2([H])[C@H](NC(/C(C3=CC=CO3)=N\OC)=O)C1=O)OC(OC(C)=O)C |
| Synonyms | Cefuroxime axetil, SN 407 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (174.34 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.59 mL | 97.95 mL | 195.9 mL |
| 0.5 mM | 3.92 mL | 19.59 mL | 39.18 mL |
| 1 mM | 1.96 mL | 9.79 mL | 19.59 mL |
| 5 mM | 0.39 mL | 1.96 mL | 3.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
