Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cephradine monohydrate (Cefradine monohydrate) is a first generation cephalosporin, which is active against a wide range of Gram positive and Gram-negative bacteria. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17949 |
|---|---|
| Formula | C16H21N3O5S |
| Molecular Weight | 367.42 |
| CAS Number | 75975-70-1 |
| SMILES | O=C(C(N12)=C(C)CS[C@]2([H])[C@H](NC([C@H](N)C3=CCC=CC3)=O)C1=O)O.[H]O[H] |
| Synonyms | Cefradine monohydrate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 4 mg/mL (10.88 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.22 mL | 136.08 mL | 272.17 mL |
| 0.5 mM | 5.44 mL | 27.22 mL | 54.43 mL |
| 1 mM | 2.72 mL | 13.61 mL | 27.22 mL |
| 5 mM | 0.54 mL | 2.72 mL | 5.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
