Loading distributor info...
| Description | CFSE is a fluorescent cell staining dye. CFSE is cell permeable and covalently couples, via its succinimidyl group, to intracellular molecules, notably, to intracellular lysine residues and other amine sources. |
|---|
| Catalog Num | A16440 |
|---|---|
| Formula | C29H19NO11 |
| Molecular Weight | 557.46 |
| CAS Number | 150347-59-4 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)C(=O)ON5C(=O)CCC5=O)C(=O)O3)C6=C(O2)C=C(C=C6)OC(=O)C |
| Synonyms | Carboxyfluorescein succinimidyl ester |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (170.41 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.94 mL | 89.69 mL | 179.39 mL |
| 0.5 mM | 3.59 mL | 17.94 mL | 35.88 mL |
| 1 mM | 1.79 mL | 8.97 mL | 17.94 mL |
| 5 mM | 0.36 mL | 1.79 mL | 3.59 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
