Loading distributor info...
| Description | CYM-5541 (ML249) is an selective and allosteric S1P3 receptor agonist with an EC50 between 72 and 132 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A20489 |
|---|---|
| Formula | C19H28N2O2 |
| Molecular Weight | 316.44 |
| CAS Number | 945128-26-7 |
| SMILES | O=C(C1=NOC(C2CC2)=C1)N(C3CCCCC3)C4CCCCC4 |
| Synonyms | CYM5541, CYM 5541; ML249, ML-249, ML 249 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 27 mg/mL (85.32 mM) | |
| Water | Insoluble | ||
| Ethanol | 54 mg/mL (170.64 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.6 mL | 158.01 mL | 316.02 mL |
| 0.5 mM | 6.32 mL | 31.6 mL | 63.2 mL |
| 1 mM | 3.16 mL | 15.8 mL | 31.6 mL |
| 5 mM | 0.63 mL | 3.16 mL | 6.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
