Loading distributor info...
| Description | D-(+)-Phenyllactic acid is an anti-bacterial agent, excreted by Geotrichum candidum, inhibits a range of Gram-positive from humans and foodstuffs and Gram-negative bacteria found in humans. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12605 |
|---|---|
| Formula | C9H10O3 |
| Molecular Weight | 166.17 |
| CAS Number | 7326-19-4 |
| SMILES | O=C(O)[C@H](O)CC1=CC=CC=C1 |
| Synonyms | D-3-Phenyllactic acid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (180.54 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 60.18 mL | 300.9 mL | 601.79 mL |
| 0.5 mM | 12.04 mL | 60.18 mL | 120.36 mL |
| 1 mM | 6.02 mL | 30.09 mL | 60.18 mL |
| 5 mM | 1.2 mL | 6.02 mL | 12.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
