Loading distributor info...
| Description | Deruxtecan-d6 is a stable isotope-labeled analog of Deruxtecan. This compound is utilized primarily in pharmacokinetic studies to accurately track the behavior of the drug in biological systems. By employing deuterium labeling, researchers can enhance the precision of their analyses in drug metabolism and efficacy research. |
|---|
| Catalog Num | A41602 |
|---|---|
| Formula | C52H50D6FN9O13 |
| Molecular Weight | 1040.09 |
| CAS Number | 2760715-89-5 |
| SMILES | O=C(C=CC1=O)N1CCCCCC(NCC(NCC(N[C@@H](CC2=CC=CC=C2)C(NC([2H])([2H])C(NC([2H])([2H])OC([2H])([2H])C(N[C@@H]3C4=C5C(C(N6C5)=CC([C@](O)(C(OC7)=O)CC)=C7C6=O)=NC8=CC(F)=C(C)C(CC3)=C84)=O)=O)=O)=O)=O)=O |
| Synonyms | MC-GGFG-DXD-d6 |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
