Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Doramapimod (BIRB 796) is a small molecule inhibitor of p38 MAPK,which plays a critical role in regulating the production of proinflammatory cytokines. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10148 |
|---|---|
| Formula | C31H37N5O3 |
| Molecular Weight | 527.7 |
| CAS Number | 285983-48-4 |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)NC3=CC=C(C4=CC=CC=C43)OCCN5CCOCC5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 99 mg/mL (187.61 mM) | |
| Water | Insoluble | ||
| Ethanol | 99 mg/mL (187.61 mM) | ||
| In vivo | 5% DMSO+40%PEG300+5%Tween80??+50%H2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.95 mL | 94.75 mL | 189.5 mL |
| 0.5 mM | 3.79 mL | 18.95 mL | 37.9 mL |
| 1 mM | 1.9 mL | 9.48 mL | 18.95 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
