Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Doxifluridine is a thymidine phosphorylase activator for PC9-DPE2 cells with IC50 of 0.62 μM. |
|---|
| Catalog Num | A11847 |
|---|---|
| Formula | C9H11FN2O5 |
| Molecular Weight | 246.19 |
| CAS Number | CAS: 3094-09-5 |
| SMILES | CC1C(C(C(O1)N2C=C(C(=O)NC2=O)F)O)O |
| Synonyms | Ro 21-9738, 5-Fluoro-5'-deoxyuridine, 5'-DFUR |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (178.72 mM) | |
| Water | 44 mg/mL (178.72 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.62 mL | 203.1 mL | 406.19 mL |
| 0.5 mM | 8.12 mL | 40.62 mL | 81.24 mL |
| 1 mM | 4.06 mL | 20.31 mL | 40.62 mL |
| 5 mM | 0.81 mL | 4.06 mL | 8.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
