Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EN6 is a novel covalent autophagy activator, targeting cysteine 277 in the ATP6V1A subunit of the lysosomal v-ATPase, which activates mTORC1 via the Rag guanosine triphosphatases. |
|---|
| Catalog Num | A18524 |
|---|---|
| Formula | C19H14F2N4O2 |
| Molecular Weight | 368.34 |
| CAS Number | 1808714-73-9 |
| SMILES | O=C(C1=CN(C2=CC=CC=C2F)N=C1)NC3=CC=C(F)C(NC(C=C)=O)=C3 |
| Synonyms | EN6; EN-6; EN 6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (184.61 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.15 mL | 135.74 mL | 271.49 mL |
| 0.5 mM | 5.43 mL | 27.15 mL | 54.3 mL |
| 1 mM | 2.71 mL | 13.57 mL | 27.15 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
