Loading distributor info...
| Description | Fingolimod is a sphingosine 1-phosphate (S1P) antagonist with IC50 of 0.033 nM in K562 and NK cells. Fingolimod also is a pak1 activator, a immunosuppressant. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A17798 |
|---|---|
| Formula | C19H33NO2 |
| Molecular Weight | 307.48 |
| CAS Number | 162359-55-9 |
| SMILES | OCC(CCC1=CC=C(CCCCCCCC)C=C1)(N)CO |
| Synonyms | Fingolimod; FTY720 (free base) |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (39.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (16.26 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.52 mL | 162.61 mL | 325.22 mL |
| 0.5 mM | 6.5 mL | 32.52 mL | 65.04 mL |
| 1 mM | 3.25 mL | 16.26 mL | 32.52 mL |
| 5 mM | 0.65 mL | 3.25 mL | 6.5 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
