Loading distributor info...
| Description | GE 2270A is an antibacterial agent that inhibits protein synthesis in gram-positive bacteria and anaerobes. This compound effectively targets bacterial ribosomes, leading to a reduction in bacterial proliferation. GE 2270A is primarily utilized in research exploring bacterial infections and antimicrobial treatments. |
|---|
| Catalog Num | A47194 |
|---|---|
| Formula | C56H55N15O10S6 |
| Molecular Weight | 1290.52 |
| CAS Number | 134861-34-0 |
| SMILES | O=C1C=2N=C(C=3C(C=4N=C(SC4)C=5N=C(SC5)[C@]([C@@H](O)C6=CC=CC=C6)(NC(=O)CNC(=O)C7=C(COC)SC([C@H](C(C)C)NC(=O)C=8N=C([C@H](CC(NC)=O)N1)SC8C)=N7)[H])=NC(=CC3)C9=NC(=CS9)C%10=N[C@H](C(=O)N%11[C@H](C(N)=O)CCC%11)CO%10)SC2 |
| Synonyms | MDL 62879 |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
