Loading distributor info...
| Description | Gemcitabine (LY 188011) is a DNA synthesis inhibitor which inhibits the growth of BxPC-3, Mia Paca-2, PANC-1, PL-45 and AsPC-1 cells with IC50s of 37.6, 42.9, 92.7, 89.3 and 131.4 nM, respectively. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11434 |
|---|---|
| Formula | C9H11F2N3O4 |
| Molecular Weight | 263.2 |
| CAS Number | 95058-81-4 |
| SMILES | O=C1N(C=CC(N)=N1)[C@H]2C(F)([C@@H]([C@H](O2)CO)O)F |
| Synonyms | LY 188011, LY188011, LY-188011 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (178.56 mM) | |
| Water | Warmed: 47 mg/mL (178.56 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | water (warmed) | 49 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.99 mL | 189.97 mL | 379.94 mL |
| 0.5 mM | 7.6 mL | 37.99 mL | 75.99 mL |
| 1 mM | 3.8 mL | 19 mL | 37.99 mL |
| 5 mM | 0.76 mL | 3.8 mL | 7.6 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
