Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Genz-644282 is a non-camptothecin inhibitor of topoisomerase I with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13206 |
|---|---|
| Formula | C22H21N3O5 |
| Molecular Weight | 407.42 |
| CAS Number | 529488-28-6 |
| SMILES | CNCCN1C2=C(C=NC3=CC4=C(C=C32)OCO4)C5=CC(=C(C=C5C1=O)OC)OC |
| Synonyms | GENZ644282; GENZ 644282 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.54 mL | 122.72 mL | 245.45 mL |
| 0.5 mM | 4.91 mL | 24.54 mL | 49.09 mL |
| 1 mM | 2.45 mL | 12.27 mL | 24.54 mL |
| 5 mM | 0.49 mL | 2.45 mL | 4.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
