Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Indisulam (E7070) is a carbonic anhydrase inhbitor, is also a novel synthetic sulfon-amide that targets the G1 phase of the cell cycle. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12325 |
|---|---|
| Formula | C14H12ClN3O4S2 |
| Molecular Weight | 385.84 |
| CAS Number | 165668-41-7 |
| SMILES | C1=CC2=C(C(=C1)NS(=O)(=O)C3=CC=C(C=C3)S(=O)(=O)N)NC=C2Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (191.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.92 mL | 129.59 mL | 259.17 mL |
| 0.5 mM | 5.18 mL | 25.92 mL | 51.83 mL |
| 1 mM | 2.59 mL | 12.96 mL | 25.92 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
