Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | IQ 3 is a selective JNK3 inhibitor (Kd values are 66, 240 and 290 nM for JNK3, JNK1 and JNK2 respectively). Inhibits NF-kB/AP1 transcriptional activity in THP1-Blue cells (IC50 = 1.4 μM). Also inhibits TNF-α and IL-6 production in vitro. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16036 |
|---|---|
| Formula | C20H11N3O3 |
| Molecular Weight | 341.32 |
| CAS Number | 312538-03-7 |
| SMILES | C1=CC=C2C(=C1)C3=NC4=CC=CC=C4N=C3C2=NOC(=O)C5=CC=CO5 |
| Synonyms | IQ3, IQ-3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (26.36 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.3 mL | 146.49 mL | 292.98 mL |
| 0.5 mM | 5.86 mL | 29.3 mL | 58.6 mL |
| 1 mM | 2.93 mL | 14.65 mL | 29.3 mL |
| 5 mM | 0.59 mL | 2.93 mL | 5.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
