Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KDM4D-IN-1 is a new histone lysine demethylase 4D (KDM4D) inhibitor with an IC50 value of 0.41±0.03 μM. |
|---|
| Catalog Num | A19545 |
|---|---|
| Formula | C11H7N5O |
| Molecular Weight | 225.21 |
| CAS Number | 2098902-68-0 |
| SMILES | OC1=NC2=C(C#N)C(C)=NN2C3=C1C=CC=N3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (26.64 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.4 mL | 222.02 mL | 444.03 mL |
| 0.5 mM | 8.88 mL | 44.4 mL | 88.81 mL |
| 1 mM | 4.44 mL | 22.2 mL | 44.4 mL |
| 5 mM | 0.89 mL | 4.44 mL | 8.88 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
