Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Levomilnacipran HCl is a selective serotonin and norepinephrine reuptake inhibitor. |
|---|
| Catalog Num | A14391 |
|---|---|
| Formula | C15H23ClN2O |
| Molecular Weight | 282.81 |
| CAS Number | 175131-60-9 |
| SMILES | CCN(CC)C(=O)[C@]1(C[C@H]1CN)C2=CC=CC=C2.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (198 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.36 mL | 176.8 mL | 353.59 mL |
| 0.5 mM | 7.07 mL | 35.36 mL | 70.72 mL |
| 1 mM | 3.54 mL | 17.68 mL | 35.36 mL |
| 5 mM | 0.71 mL | 3.54 mL | 7.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
