Loading distributor info...
| Description | Lidocaine hydrochloride is a local anesthetic and cardiac depressant used as an antiarrhythmia agent. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16132 |
|---|---|
| Formula | C14H23ClN2O |
| Molecular Weight | 270.8 |
| CAS Number | 73-78-9 |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (169.86 mM) | |
| Water | 46 mg/mL (169.86 mM) | ||
| Ethanol | 46 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.93 mL | 184.64 mL | 369.28 mL |
| 0.5 mM | 7.39 mL | 36.93 mL | 73.86 mL |
| 1 mM | 3.69 mL | 18.46 mL | 36.93 mL |
| 5 mM | 0.74 mL | 3.69 mL | 7.39 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
