Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (-)-Menthol is a key component of peppermint oil that binds and activates transient receptor potential melastatin 8 (TRPM8), a Ca2+-permeable nonselective cation channel, to increase [Ca2+]i. Antitumor activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15621 |
|---|---|
| Formula | C10H20O |
| Molecular Weight | 156.27 |
| CAS Number | 2216-51-5 |
| SMILES | O[C@H]1[C@H](C(C)C)CC[C@@H](C)C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 29 mg/mL (185.57 mM) | |
| Water | 15 mg/mL (95.98 mM) | ||
| Ethanol | 29 mg/mL (185.57 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 63.99 mL | 319.96 mL | 639.92 mL |
| 0.5 mM | 12.8 mL | 63.99 mL | 127.98 mL |
| 1 mM | 6.4 mL | 32 mL | 63.99 mL |
| 5 mM | 1.28 mL | 6.4 mL | 12.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
