Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Methyl vanillate, one of the ingredients in Hovenia dulcis Thunb, is a Wnt/β-catenin pathway activator. A benzoate ester that is the methyl ester of vanillic acid. It has a role as an antioxidant and a plant metabolite. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20626 |
|---|---|
| Formula | C9H10O4 |
| Molecular Weight | 182.17 |
| CAS Number | 3943-74-6 |
| SMILES | O=C(OC)C(C=C1)=CC(OC)=C1O |
| Synonyms | NSC 74385; NSC-74385; NSC74385 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (192.12 mM) | |
| Water | 12 mg/mL (65.87 mM) | ||
| Ethanol | 35 mg/mL (192.12 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 54.89 mL | 274.47 mL | 548.94 mL |
| 0.5 mM | 10.98 mL | 54.89 mL | 109.79 mL |
| 1 mM | 5.49 mL | 27.45 mL | 54.89 mL |
| 5 mM | 1.1 mL | 5.49 mL | 10.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
