Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Natamycin (Pimaricin) is a naturally occurring antifungal agent produced during fermentation by the bacterium Streptomyces natalensis, commonly found in soil.It is used to treat fungal infections. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10628 |
|---|---|
| Formula | C33H47NO13 |
| Molecular Weight | 665.7 |
| CAS Number | 7681-93-8 |
| SMILES | C[C@@H]1C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@@H]3[C@H](O3)/C=C/C(=O)O1)O)O)O)C(=O)O)OC4[C@H]([C@H]([C@@H]([C@H](O4)C)O)N)O |
| Synonyms | Natacyn |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (10.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.02 mL | 75.11 mL | 150.22 mL |
| 0.5 mM | 3 mL | 15.02 mL | 30.04 mL |
| 1 mM | 1.5 mL | 7.51 mL | 15.02 mL |
| 5 mM | 0.3 mL | 1.5 mL | 3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
