Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NCB-0846 is an orally available TNIK inhibitor with an IC50 of 21?nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20535 |
|---|---|
| Formula | C21H21N5O2 |
| Molecular Weight | 375.42 |
| CAS Number | 1792999-26-8 |
| SMILES | O[C@@H](CC1)CC[C@@H]1OC2=CC=CC(C=N3)=C2N=C3NC4=CC=C(N=CN5)C5=C4 |
| Synonyms | NCB 0846, NCB0846 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 70 mg/mL (186.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.64 mL | 133.18 mL | 266.37 mL |
| 0.5 mM | 5.33 mL | 26.64 mL | 53.27 mL |
| 1 mM | 2.66 mL | 13.32 mL | 26.64 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
