Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-06840003 is a highly selective orally bioavailable IDO-1 inhibitor with IC50s of 0.41 μM, 0.59 μM, and 1.5 μM for hIDO-1, dIDO-1, and mIDO-1, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20807 |
|---|---|
| Formula | C12H9FN2O2 |
| Molecular Weight | 232.21 |
| CAS Number | 198474-05-4 |
| SMILES | O=C(C(C1=CNC2=C1C=C(F)C=C2)C3)NC3=O |
| Synonyms | PF06840003, PF 06840003; EOS200271, EOS 200271, EOS-200271 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 40 mg/mL (172.25 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.06 mL | 215.32 mL | 430.64 mL |
| 0.5 mM | 8.61 mL | 43.06 mL | 86.13 mL |
| 1 mM | 4.31 mL | 21.53 mL | 43.06 mL |
| 5 mM | 0.86 mL | 4.31 mL | 8.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
