Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phenoxodiol, a synthetic analog of Genestein, activates the mitochondrial caspase system, inhibits XIAP (an apoptosis inhibitor), and sensitizes the cancer cells to Fas-mediated apoptosis. |
|---|
| Catalog Num | A21147 |
|---|---|
| Formula | C15H12O3 |
| Molecular Weight | 240.25 |
| CAS Number | 81267-65-4 |
| SMILES | OC1=CC=C2C=C(C3=CC=C(O)C=C3)COC2=C1 |
| Synonyms | Idronoxil; Dehydroequol; Haginin E |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (178.98 mM) | |
| Water | Insoluble | ||
| Ethanol | 43 mg/mL (178.98 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.62 mL | 208.12 mL | 416.23 mL |
| 0.5 mM | 8.32 mL | 41.62 mL | 83.25 mL |
| 1 mM | 4.16 mL | 20.81 mL | 41.62 mL |
| 5 mM | 0.83 mL | 4.16 mL | 8.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
