Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PKM2-IN-1 is a pyruvate kinase M2 (PKM2) inhibitor with an IC50 of 2.95 μM. |
|---|
| Catalog Num | A20086 |
|---|---|
| Formula | C18H19NO2S2 |
| Molecular Weight | 345.48 |
| CAS Number | 94164-88-2 |
| SMILES | S=C(N1CCCCC1)SCC(C2=O)=C(C)C(C3=C2C=CC=C3)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (14.47 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.95 mL | 144.73 mL | 289.45 mL |
| 0.5 mM | 5.79 mL | 28.95 mL | 57.89 mL |
| 1 mM | 2.89 mL | 14.47 mL | 28.95 mL |
| 5 mM | 0.58 mL | 2.89 mL | 5.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
