Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PLpro inhibitor is a potent inhibitor of papain-like protease (PLpro) with IC50 of 2.6 uM. |
|---|
| Catalog Num | A21044 |
|---|---|
| Formula | C22H22N2O2 |
| Molecular Weight | 346.42 |
| CAS Number | 1093070-14-4 |
| SMILES | O=C(C1=CC(NC(C)=O)=CC=C1C)N[C@H](C)C2=C(C=CC=C3)C3=CC=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (187.63 mM) | |
| Water | Insoluble | ||
| Ethanol | 33 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.87 mL | 144.33 mL | 288.67 mL |
| 0.5 mM | 5.77 mL | 28.87 mL | 57.73 mL |
| 1 mM | 2.89 mL | 14.43 mL | 28.87 mL |
| 5 mM | 0.58 mL | 2.89 mL | 5.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
