Loading distributor info...
| Description | Prodigiosin (Prodigiosine) is a secondary metabolite of Symbiotic bacteria, with anti-fungal and anti-cancer activity. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A13710 |
|---|---|
| Formula | C20H25N3O |
| Molecular Weight | 323.43 |
| CAS Number | 82-89-3 |
| SMILES | CCCCCC1=C/C(N=C1C)=C\C2=C(OC)C=C(C3=CC=CN3)N2 |
| Synonyms | Prodigiosine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (122.01 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.92 mL | 154.59 mL | 309.19 mL |
| 0.5 mM | 6.18 mL | 30.92 mL | 61.84 mL |
| 1 mM | 3.09 mL | 15.46 mL | 30.92 mL |
| 5 mM | 0.62 mL | 3.09 mL | 6.18 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
