Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Relebactam is a diazabicyclooctane inhibitor with activity against a wide spectrum of β-lactamases, including class A (extended-spectrum β-lactamases [ESBLs] and KPC) and class C (AmpC) enzymes. |
|---|
| Catalog Num | A21071 |
|---|---|
| Formula | C12H20N4O6S |
| Molecular Weight | 348.38 |
| CAS Number | 1174018-99-5 |
| SMILES | O=S(ON1[C@]2([H])CC[C@@H](C(NC3CCNCC3)=O)[N@@](C2)C1=O)(O)=O |
| Synonyms | MK-7655, MK 7655, MK7655 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (192.32 mM) | |
| Water | 67 mg/mL (192.32 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.7 mL | 143.52 mL | 287.04 mL |
| 0.5 mM | 5.74 mL | 28.7 mL | 57.41 mL |
| 1 mM | 2.87 mL | 14.35 mL | 28.7 mL |
| 5 mM | 0.57 mL | 2.87 mL | 5.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
