Loading distributor info...
| Description | SC-514 is an orally active, ATP-competitive IKKβ inhibitor (IC50 = 3 - 12 μM) that displays > 10-fold selectivity over 28 other kinases including JNK, p38, MK2 and ERK. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A12746 |
|---|---|
| Formula | C9H8N2OS2 |
| Molecular Weight | 224.3 |
| CAS Number | 354812-17-2 |
| SMILES | C1=CSC=C1C2=CC(=C(S2)C(=O)N)N |
| Synonyms | SC514, SC 514 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 41 mg/mL (182.79 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 3 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.58 mL | 222.92 mL | 445.83 mL |
| 0.5 mM | 8.92 mL | 44.58 mL | 89.17 mL |
| 1 mM | 4.46 mL | 22.29 mL | 44.58 mL |
| 5 mM | 0.89 mL | 4.46 mL | 8.92 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
