Loading distributor info...
| Description | SD-06 is a p38 MAP kinase inhibitor; inhibits p38α with an IC50 value of 170 nM and inhibits LPS-stimulated TNF-release in rats (83% inhibition at 1mg/kg, po). |
|---|
| Catalog Num | A11563 |
|---|---|
| Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 |
| CAS Number | 271576-80-8 |
| SMILES | C1CN(CCC1C2=C(C(=NN2)C3=CC=C(C=C3)Cl)C4=NC=NC=C4)C(=O)CO |
| Synonyms | SD 06, SD06 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (193.53 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (5.02 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.13 mL | 125.67 mL | 251.34 mL |
| 0.5 mM | 5.03 mL | 25.13 mL | 50.27 mL |
| 1 mM | 2.51 mL | 12.57 mL | 25.13 mL |
| 5 mM | 0.5 mL | 2.51 mL | 5.03 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
