Loading distributor info...
| Description | SNIPER(ABL)-039, conjugating Dasatinib (ABL inhibitor) to LCL161 derivative (IAP ligand) with a linker, induces the reduction of BCR-ABL protein with a DC50 of 10 nM. IC50s are 0.54 nM, 10 nM, 12 nM, and 50 nM for ABL, cIAP1, cIAP2, XIAP, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19588 |
|---|---|
| Formula | C54H68ClN11O9S2 |
| Molecular Weight | 1114.77 |
| CAS Number | 2222354-29-0 |
| SMILES | CC1=C(NC(C2=CN=C(NC3=CC(N4CCN(C(COCCOCCOCCOC5=CC(C(C6=CSC([C@H]7N(C([C@H](C8CCCCC8)NC([C@H](C)NC)=O)=O)CCC7)=N6)=O)=CC=C5)=O)CC4)=NC(C)=N3)S2)=O)C(Cl)=CC=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
