Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SR-4370 is an HDAC inhibitor. SR-4370 exhibited IC50 values of 0.5 μM, 0.1 μM and 0.06 μM towards HDAC1, HDAC2 and HDAC3, resp. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16899 |
|---|---|
| Formula | C17H18F2N2O |
| Molecular Weight | 304.34 |
| CAS Number | 1816294-67-3 |
| SMILES | O=C(C1=CC=C(C2=CC=CC(F)=C2F)C=C1)NNCCCC |
| Synonyms | SR-4370, SR-4370 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (184.01 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL (184.01 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.86 mL | 164.29 mL | 328.58 mL |
| 0.5 mM | 6.57 mL | 32.86 mL | 65.72 mL |
| 1 mM | 3.29 mL | 16.43 mL | 32.86 mL |
| 5 mM | 0.66 mL | 3.29 mL | 6.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
