Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sulbenicillin disodium is a semisynthetic penicillin-type antibiotic. |
|---|
| Catalog Num | A17598 |
|---|---|
| Formula | C16H16N2Na2O7S2 |
| Molecular Weight | 458.41 |
| CAS Number | 28002-18-8 |
| SMILES | O=C(C(C(C)(C)SC1C2NC(C(C3=CC=CC=C3)S(=O)([O-])=O)=O)N1C2=O)[O-].[Na+].[Na+] |
| Synonyms | Sulbenicillin disodium; alpha-Sulfobenzylpenicillin disodium; Disodium sulbenicillin; Disodium sulfobenzylpenicillin; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (174.51 mM) | |
| Water | 80 mg/mL (174.51 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.81 mL | 109.07 mL | 218.15 mL |
| 0.5 mM | 4.36 mL | 21.81 mL | 43.63 mL |
| 1 mM | 2.18 mL | 10.91 mL | 21.81 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
