Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tacrine hydrochloride hydrate is an inhibitor of both acetyl (AChE) and butyryl-cholinestrase (BChE) with IC50s of 31 nM and 25.6 nM, respectively. |
|---|
| Catalog Num | A16970 |
|---|---|
| Formula | C13H17ClN2O |
| Molecular Weight | 252.74 |
| CAS Number | 206658-92-6 |
| SMILES | NC1=C(CCCC2)C2=NC3=CC=CC=C31.[H]Cl.O |
| Synonyms | THA hydrochloride hydrate, Tetrahydroaminacrine hydrochloride hydrate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL | |
| Water | 43 mg/mL | ||
| Ethanol | 43 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.57 mL | 197.83 mL | 395.66 mL |
| 0.5 mM | 7.91 mL | 39.57 mL | 79.13 mL |
| 1 mM | 3.96 mL | 19.78 mL | 39.57 mL |
| 5 mM | 0.79 mL | 3.96 mL | 7.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
