Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAS4464 is a highly potent and selective inhibitor of NEDD8 activating enzyme (NAE), with an IC50 of 0.955 nM. |
|---|
| Catalog Num | A18485 |
|---|---|
| Formula | C21H23FN6O6S |
| Molecular Weight | 506.5 |
| CAS Number | 1848959-10-3 |
| SMILES | NC1=C2C(N([C@H]3[C@@H]([C@@H]([C@@H](CNS(=O)(N)=O)O3)O)O)C=C2C#CC4=C(F)C=CC=C4OCC)=NC=N1 |
| Synonyms | TAS4464; TAS-4464; TAS 4464 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (177.68 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.74 mL | 98.72 mL | 197.43 mL |
| 0.5 mM | 3.95 mL | 19.74 mL | 39.49 mL |
| 1 mM | 1.97 mL | 9.87 mL | 19.74 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
