Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tauroursodeoxycholate (TUDCA; UR 906; Taurolite) is an endoplasmic reticulum (ER) stress inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17271 |
|---|---|
| Formula | C26H45NO6S |
| Molecular Weight | 499.7 |
| CAS Number | 14605-22-2 |
| SMILES | C[C@H](CCC(NCCS(=O)(O)=O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])[C@@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Synonyms | TUDCA; UR 906; Taurolite, UR906, UR-906 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (168.09 mM) | |
| Water | 26 mg/mL (52.03 mM) | ||
| Ethanol | 84 mg/mL (168.09 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.01 mL | 100.06 mL | 200.12 mL |
| 0.5 mM | 4 mL | 20.01 mL | 40.02 mL |
| 1 mM | 2 mL | 10.01 mL | 20.01 mL |
| 5 mM | 0.4 mL | 2 mL | 4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
