Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TH34, an HDAC6/8/10 inhibitor with IC50s of 4.6 μM, 1.9 μM, and 7.7 μM respectively, shows high selectivity over HDAC1/2/3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19873 |
|---|---|
| Formula | C15H16N2O2 |
| Molecular Weight | 256.3 |
| CAS Number | 2196203-96-8 |
| SMILES | O=C(NO)C1=CC=C(C)C(NCC2=CC=CC=C2)=C1 |
| Synonyms | TH 34, TH-34 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (191.18 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (54.62 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.02 mL | 195.08 mL | 390.17 mL |
| 0.5 mM | 7.8 mL | 39.02 mL | 78.03 mL |
| 1 mM | 3.9 mL | 19.51 mL | 39.02 mL |
| 5 mM | 0.78 mL | 3.9 mL | 7.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
