Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TH588 is first-in-class nudix hydrolase family inhibitor that potently and selectively engage and inhibit the MTH1(IC50= 5 nM) in cells, | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15537 |
|---|---|
| Formula | C13H12Cl2N4 |
| Molecular Weight | 295.17 |
| CAS Number | 1609960-31-7 |
| SMILES | C1CC1NC2=NC(=NC(=C2)C3=C(C(=CC=C3)Cl)Cl)N |
| Synonyms | TH-588, TH 588 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 19 mg/mL (64.36 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 1 mg/mL (3.38 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.88 mL | 169.39 mL | 338.79 mL |
| 0.5 mM | 6.78 mL | 33.88 mL | 67.76 mL |
| 1 mM | 3.39 mL | 16.94 mL | 33.88 mL |
| 5 mM | 0.68 mL | 3.39 mL | 6.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
