Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tirofiban, Hydrochloride Hydrate is a specific nonpeptide platelet fibrinogen receptor (GPIIb/IIIa) antagonist. |
|---|
| Catalog Num | A13783 |
|---|---|
| Formula | C22H36N2O5S.HCl.H2O |
| Molecular Weight | 495.07 |
| CAS Number | 150915-40-5 |
| SMILES | CCCCS(=O)(=O)N[C@@H](CC1=CC=C(C=C1)OCCCCC2CCNCC2)C(=O)O.O.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL (185.83 mM) | |
| Water | 92 mg/mL (185.83 mM) | ||
| Ethanol | 92 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.2 mL | 101 mL | 201.99 mL |
| 0.5 mM | 4.04 mL | 20.2 mL | 40.4 mL |
| 1 mM | 2.02 mL | 10.1 mL | 20.2 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
