Loading distributor info...
| Description | Triclabendazole is an anthelmintic and fasciolicidal, binding to beta-tubulin and preventing the polymerization of the microtubules of which they are part. |
|---|
| Catalog Num | A16761 |
|---|---|
| Formula | C14H9Cl3N2OS |
| Molecular Weight | 359.66 |
| CAS Number | 68786-66-3 |
| SMILES | CSC1=NC2=CC(OC3=CC=CC(Cl)=C3Cl)=C(Cl)C=C2N1 |
| Synonyms | CGA89317, CGA 89317, CGA-89317 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (169.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.8 mL | 139.02 mL | 278.04 mL |
| 0.5 mM | 5.56 mL | 27.8 mL | 55.61 mL |
| 1 mM | 2.78 mL | 13.9 mL | 27.8 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.56 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
