Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tubacin (tubulin acetylation inducer) is a highly potent and selective, reversible, cell-permeable HDAC6 inhibitor with an IC50 of 4 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10954 |
|---|---|
| Formula | C41H43N3O7S |
| Molecular Weight | 721.9 |
| CAS Number | 537049-40-4 |
| SMILES | C1[C@@H](O[C@@H](O[C@@H]1C2=CC=C(C=C2)CO)C3=CC=C(C=C3)NC(=O)CCCCCCC(=O)NO)CSC4=NC(=C(O4)C5=CC=CC=C5)C6=CC=CC=C6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 93 mg/mL (128.83 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.85 mL | 69.26 mL | 138.52 mL |
| 0.5 mM | 2.77 mL | 13.85 mL | 27.7 mL |
| 1 mM | 1.39 mL | 6.93 mL | 13.85 mL |
| 5 mM | 0.28 mL | 1.39 mL | 2.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
