Loading distributor info...
| Description | VR23 is a small molecule that potently inhibited the activities of trypsin-like proteasomes (IC50 = 1 nM), chymotrypsin-like proteasomes (IC50 = 50-100 nM), and caspase-like proteasomes (IC50 = 3uM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13650 |
|---|---|
| Formula | C19H16ClN5O6S |
| Molecular Weight | 477.88 |
| CAS Number | 1624602-30-7 |
| SMILES | ClC1=CC2=C(C(N3CCN(S(C4=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C4)(=O)=O)CC3)=CC=N2)C=C1 |
| Synonyms | VR-23, VR 23 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 29 mg/mL (60.68 mM) | |
| Water | Warmed: 5 mg/mL (10.46 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.93 mL | 104.63 mL | 209.26 mL |
| 0.5 mM | 4.19 mL | 20.93 mL | 41.85 mL |
| 1 mM | 2.09 mL | 10.46 mL | 20.93 mL |
| 5 mM | 0.42 mL | 2.09 mL | 4.19 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
