Signaling Pathway
mAChR5 modulator
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VU 0238429 is positive allosteric modulator of muscarinic acetylcholine receptor subtype 5 (mAChR5 or M5), with an EC50 of 1.16 μM. |
|---|
| Catalog Num | A21519 |
|---|---|
| Formula | C17H12F3NO4 |
| Molecular Weight | 351.28 |
| CAS Number | 1160247-92-6 |
| SMILES | O=C1N(CC2=CC=C(OC)C=C2)C3=C(C=C(OC(F)(F)F)C=C3)C1=O |
| Synonyms | VU0238429, VU-0238429 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (187.88 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (48.39 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.47 mL | 142.34 mL | 284.67 mL |
| 0.5 mM | 5.69 mL | 28.47 mL | 56.93 mL |
| 1 mM | 2.85 mL | 14.23 mL | 28.47 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.69 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
