Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WT-161 is a potent and selective HDAC6 inhibitor with an IC50 of 0.40 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20432 |
|---|---|
| Formula | C27H30N4O3 |
| Molecular Weight | 458.55 |
| CAS Number | 1206731-57-8 |
| SMILES | O=C(N/N=C/C1=CC=C(N(C2=CC=CC=C2)C3=CC=CC=C3)C=C1)CCCCCCC(NO)=O |
| Synonyms | WT161; WT 161 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (163.55 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.18 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.81 mL | 109.04 mL | 218.08 mL |
| 0.5 mM | 4.36 mL | 21.81 mL | 43.62 mL |
| 1 mM | 2.18 mL | 10.9 mL | 21.81 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
