Loading distributor info...
| Description | Zucapsaicin, also known as cis-Capsaicin, is a medication used to treat osteoarthritis of the knee and other neuropathic pain. It is applied three times daily for a maximum of three months. It reduces pain, and improves articular functions. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A18179 |
|---|---|
| Formula | C18H27NO3 |
| Molecular Weight | 305.42 |
| CAS Number | 25775-90-0 |
| SMILES | CC(C)/C=C\CCCCC(NCC1=CC=C(O)C(OC)=C1)=O |
| Synonyms | BRN 4261852; cis-Capsaicin; Civamide; Zucapsaicin, trade name Civanex. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (183.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL (183.36 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.74 mL | 163.71 mL | 327.42 mL |
| 0.5 mM | 6.55 mL | 32.74 mL | 65.48 mL |
| 1 mM | 3.27 mL | 16.37 mL | 32.74 mL |
| 5 mM | 0.65 mL | 3.27 mL | 6.55 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
