Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AVL-292 is a highly selective, covalent Btk inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13202 |
|---|---|
| Formula | C22H22FN5O3 |
| Molecular Weight | 423.44 |
| CAS Number | 1202757-89-8 |
| SMILES | COCCOC1=CC=C(C=C1)NC2=NC=C(C(=N2)NC3=CC(=CC=C3)NC(=O)C=C)F |
| Synonyms | AVL292, AVL 292, CC292, CC-292, CC 292 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (184.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.62 mL | 118.08 mL | 236.16 mL |
| 0.5 mM | 4.72 mL | 23.62 mL | 47.23 mL |
| 1 mM | 2.36 mL | 11.81 mL | 23.62 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
