Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Belinostat (PXD101) is a HDAC inhibitor that inhibits HDAC activity in HeLa cell extracts with an IC50 of 27 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10122 |
|---|---|
| Formula | C15H14N2O4S |
| Molecular Weight | 318.4 |
| CAS Number | 414864-00-9 |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)/C=C/C(=O)NO |
| Synonyms | PX105684 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 56 mg/mL (175.9 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.41 mL | 157.04 mL | 314.07 mL |
| 0.5 mM | 6.28 mL | 31.41 mL | 62.81 mL |
| 1 mM | 3.14 mL | 15.7 mL | 31.41 mL |
| 5 mM | 0.63 mL | 3.14 mL | 6.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
